EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N3O5S |
| Net Charge | 0 |
| Average Mass | 493.585 |
| Monoisotopic Mass | 493.16714 |
| SMILES | COc1c(-c2ccc3cc(NS(C)(=O)=O)ccc3c2)cc(-n2ccc(=O)nc2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C26H27N3O5S/c1-26(2,3)22-15-20(29-11-10-23(30)27-25(29)31)14-21(24(22)34-4)18-7-6-17-13-19(28-35(5,32)33)9-8-16(17)12-18/h6-15,28H,1-5H3,(H,27,30,31) |
| InChIKey | NBRBXGKOEOGLOI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nonnucleoside hepatitis C virus polymerase inhibitor Any inhibitor of nonnucleoside hepatitis C virus polymerase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasabuvir (CHEBI:85182) has functional parent uracil (CHEBI:17568) |
| dasabuvir (CHEBI:85182) has role antiviral drug (CHEBI:36044) |
| dasabuvir (CHEBI:85182) has role nonnucleoside hepatitis C virus polymerase inhibitor (CHEBI:85180) |
| dasabuvir (CHEBI:85182) is a aromatic ether (CHEBI:35618) |
| dasabuvir (CHEBI:85182) is a naphthalenes (CHEBI:25477) |
| dasabuvir (CHEBI:85182) is a pyrimidone (CHEBI:38337) |
| dasabuvir (CHEBI:85182) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-{6-[3-tert-butyl-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-2-methoxyphenyl]naphthalen-2-yl}methanesulfonamide |
| INN | Source |
|---|---|
| dasabuvir | KEGG DRUG |
| Synonym | Source |
|---|---|
| ABT 333 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19076087 | Reaxys |
| CAS:1132935-63-7 | KEGG DRUG |
| CAS:1132935-63-7 | ChemIDplus |
| Citations |
|---|