EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N3O5S.Na |
| Net Charge | 0 |
| Average Mass | 515.567 |
| Monoisotopic Mass | 515.14909 |
| SMILES | COc1c(-c2ccc3cc([N-]S(C)(=O)=O)ccc3c2)cc(-n2ccc(=O)nc2=O)cc1C(C)(C)C.[Na+] |
| InChI | InChI=1S/C26H26N3O5S.Na/c1-26(2,3)22-15-20(29-11-10-23(30)27-25(29)31)14-21(24(22)34-4)18-7-6-17-13-19(28-35(5,32)33)9-8-16(17)12-18;/h6-15H,1-5H3,(H,27,30,31);/q-1;+1 |
| InChIKey | VZCGKKLFRJCTFM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nonnucleoside hepatitis C virus polymerase inhibitor Any inhibitor of nonnucleoside hepatitis C virus polymerase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasabuvir sodium (CHEBI:85179) has part dasabuvir(1−) (CHEBI:85181) |
| dasabuvir sodium (CHEBI:85179) has role antiviral drug (CHEBI:36044) |
| dasabuvir sodium (CHEBI:85179) has role nonnucleoside hepatitis C virus polymerase inhibitor (CHEBI:85180) |
| dasabuvir sodium (CHEBI:85179) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| dasabuvir sodium hydrate (CHEBI:85178) has part dasabuvir sodium (CHEBI:85179) |
| IUPAC Name |
|---|
| sodium {6-[3-tert-butyl-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-2-methoxyphenyl]naphthalen-2-yl}(methanesulfonyl)azanide |
| Synonyms | Source |
|---|---|
| ABT-333 sodium | ChemIDplus |
| Dasabuvir sodium anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Dasabuvir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19076517 | Reaxys |
| CAS:1132940-11-4 | ChemIDplus |
| Citations |
|---|