EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19FN4O4 |
| Net Charge | 0 |
| Average Mass | 398.394 |
| Monoisotopic Mass | 398.13903 |
| SMILES | [H][C@]12CN(c3c(F)cc4c(=O)c(C(=O)O)cn(C5CC5)c4c3C#N)C[C@]1([H])OCCN2 |
| InChI | InChI=1S/C20H19FN4O4/c21-14-5-11-17(25(10-1-2-10)7-13(19(11)26)20(27)28)12(6-22)18(14)24-8-15-16(9-24)29-4-3-23-15/h5,7,10,15-16,23H,1-4,8-9H2,(H,27,28)/t15-,16-/m0/s1 |
| InChIKey | FYMHQCNFKNMJAV-HOTGVXAUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| finafloxacin (CHEBI:85176) has role antibacterial drug (CHEBI:36047) |
| finafloxacin (CHEBI:85176) has role antimicrobial agent (CHEBI:33281) |
| finafloxacin (CHEBI:85176) is a cyclopropanes (CHEBI:51454) |
| finafloxacin (CHEBI:85176) is a monocarboxylic acid (CHEBI:25384) |
| finafloxacin (CHEBI:85176) is a nitrile (CHEBI:18379) |
| finafloxacin (CHEBI:85176) is a organofluorine compound (CHEBI:37143) |
| finafloxacin (CHEBI:85176) is a quinolone (CHEBI:23765) |
| finafloxacin (CHEBI:85176) is a secondary amino compound (CHEBI:50995) |
| finafloxacin (CHEBI:85176) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-cyano-1-cyclopropyl-6-fluoro-7-[(4aS,7aS)-hexahydropyrrolo[3,4-b][1,4]oxazin-6(2H)-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INN | Source |
|---|---|
| finafloxacin | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Xtoro | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4920 | DrugCentral |
| D10575 | KEGG DRUG |
| Finafloxacin | Wikipedia |
| WO2011003091 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14830297 | Reaxys |
| CAS:209342-40-5 | ChemIDplus |
| CAS:209342-40-5 | KEGG DRUG |
| Citations |
|---|