EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCc1c(O)ccc2c1OC(c1ccc(O)cc1O)CC2=O |
| InChI | InChI=1S/C20H20O5/c1-11(2)3-5-14-16(22)8-7-15-18(24)10-19(25-20(14)15)13-6-4-12(21)9-17(13)23/h3-4,6-9,19,21-23H,5,10H2,1-2H3 |
| InChIKey | JJOUBYOHNYJCOU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| euchrenone-a7 (CHEBI:85169) has role plant metabolite (CHEBI:76924) |
| euchrenone-a7 (CHEBI:85169) is a 4'-hydroxyflavanones (CHEBI:140331) |
| euchrenone-a7 (CHEBI:85169) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-7-hydroxy-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4206221 | Reaxys |
| Citations |
|---|