EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.18886 |
| SMILES | [H][C@]12CCCc3cccc(c31)C(=O)N([C@@H]1CN3CCC1CC3)C2 |
| InChI | InChI=1S/C19H24N2O/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20/h2,4,6,13,15,17H,1,3,5,7-12H2/t15-,17-/m1/s1 |
| InChIKey | CPZBLNMUGSZIPR-NVXWUHKLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palonosetron (CHEBI:85161) has role antiemetic (CHEBI:50919) |
| palonosetron (CHEBI:85161) has role serotonergic antagonist (CHEBI:48279) |
| palonosetron (CHEBI:85161) is a azabicycloalkane (CHEBI:38295) |
| palonosetron (CHEBI:85161) is a organic heterotricyclic compound (CHEBI:26979) |
| palonosetron (CHEBI:85161) is a δ-lactam (CHEBI:77727) |
| palonosetron (CHEBI:85161) is conjugate base of palonosetron(1+) (CHEBI:85163) |
| Incoming Relation(s) |
| palonosetron(1+) (CHEBI:85163) is conjugate acid of palonosetron (CHEBI:85161) |
| IUPAC Name |
|---|
| (3aS)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-one |
| INNs | Source |
|---|---|
| palonosetron | KEGG DRUG |
| palonosetron | DrugBank |
| palonosetrón | DrugBank |
| palonosétron | DrugBank |
| palonosetronum | DrugBank |
| Synonym | Source |
|---|---|
| 2-(1-Azabicyclo(2.2.2)oct-3-yl)-2,3,3a,4,5,6-hexahydro-1H-benz(de)isoquinolin-1-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2046 | DrugCentral |
| D07175 | KEGG DRUG |
| DB00377 | DrugBank |
| HMDB0014521 | HMDB |
| LSM-5266 | LINCS |
| Palonosetron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:135729-61-2 | KEGG DRUG |
| CAS:135729-61-2 | ChemIDplus |
| Citations |
|---|