EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.18886 |
| SMILES | [H][C@]12CCCc3cccc(c31)C(=O)N([C@@H]1CN3CCC1CC3)C2 |
| InChI | InChI=1S/C19H24N2O/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20/h2,4,6,13,15,17H,1,3,5,7-12H2/t15-,17-/m1/s1 |
| InChIKey | CPZBLNMUGSZIPR-NVXWUHKLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palonosetron (CHEBI:85161) has role antiemetic (CHEBI:50919) |
| palonosetron (CHEBI:85161) has role serotonergic antagonist (CHEBI:48279) |
| palonosetron (CHEBI:85161) is a azabicycloalkane (CHEBI:38295) |
| palonosetron (CHEBI:85161) is a organic heterotricyclic compound (CHEBI:26979) |
| palonosetron (CHEBI:85161) is a δ-lactam (CHEBI:77727) |
| palonosetron (CHEBI:85161) is conjugate base of palonosetron(1+) (CHEBI:85163) |
| Incoming Relation(s) |
| palonosetron(1+) (CHEBI:85163) is conjugate acid of palonosetron (CHEBI:85161) |
| IUPAC Name |
|---|
| (3aS)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-one |
| INNs | Source |
|---|---|
| palonosetrón | DrugBank |
| palonosetron | DrugBank |
| palonosétron | DrugBank |
| palonosetronum | DrugBank |
| palonosetron | KEGG DRUG |
| Synonym | Source |
|---|---|
| 2-(1-Azabicyclo(2.2.2)oct-3-yl)-2,3,3a,4,5,6-hexahydro-1H-benz(de)isoquinolin-1-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00377 | DrugBank |
| D07175 | KEGG DRUG |
| HMDB0014521 | HMDB |
| Palonosetron | Wikipedia |
| LSM-5266 | LINCS |
| 2046 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:135729-61-2 | KEGG DRUG |
| CAS:135729-61-2 | ChemIDplus |
| Citations |
|---|