EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O.HCl |
| Net Charge | 0 |
| Average Mass | 332.875 |
| Monoisotopic Mass | 332.16554 |
| SMILES | Cl.[H][C@]12CCCc3cccc(c31)C(=O)N([C@@H]1CN3CCC1CC3)C2 |
| InChI | InChI=1S/C19H24N2O.ClH/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20;/h2,4,6,13,15,17H,1,3,5,7-12H2;1H/t15-,17-;/m1./s1 |
| InChIKey | OLDRWYVIKMSFFB-SSPJITILSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palonosetron hydrochloride (CHEBI:85157) has part palonosetron(1+) (CHEBI:85163) |
| palonosetron hydrochloride (CHEBI:85157) has role antiemetic (CHEBI:50919) |
| palonosetron hydrochloride (CHEBI:85157) has role serotonergic antagonist (CHEBI:48279) |
| palonosetron hydrochloride (CHEBI:85157) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Akynzeo (CHEBI:85154) has part palonosetron hydrochloride (CHEBI:85157) |
| IUPAC Names |
|---|
| (3aS)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-one—hydrogen chloride (1/1) |
| (3S)-3-[(3aS)-1-oxo-3a,4,5,6-tetrahydro-1H-benzo[de]isoquinolin-2(3H)-yl]-1-azabicyclo[2.2.2]octan-1-ium chloride |
| Brand Name | Source |
|---|---|
| Aloxi | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21177207 | Reaxys |
| Reaxys:6641153 | Reaxys |
| CAS:135729-62-3 | KEGG DRUG |
| CAS:135729-62-3 | ChemIDplus |
| Citations |
|---|