EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O.HCl |
| Net Charge | 0 |
| Average Mass | 332.875 |
| Monoisotopic Mass | 332.16554 |
| SMILES | Cl.[H][C@]12CCCc3cccc(c31)C(=O)N([C@@H]1CN3CCC1CC3)C2 |
| InChI | InChI=1S/C19H24N2O.ClH/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20;/h2,4,6,13,15,17H,1,3,5,7-12H2;1H/t15-,17-;/m1./s1 |
| InChIKey | OLDRWYVIKMSFFB-SSPJITILSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palonosetron hydrochloride (CHEBI:85157) has part palonosetron(1+) (CHEBI:85163) |
| palonosetron hydrochloride (CHEBI:85157) has role antiemetic (CHEBI:50919) |
| palonosetron hydrochloride (CHEBI:85157) has role antineoplastic agent (CHEBI:35610) |
| palonosetron hydrochloride (CHEBI:85157) has role serotonergic antagonist (CHEBI:48279) |
| palonosetron hydrochloride (CHEBI:85157) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Akynzeo (CHEBI:85154) has part palonosetron hydrochloride (CHEBI:85157) |
| IUPAC Names |
|---|
| (3aS)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-one—hydrogen chloride (1/1) |
| (3S)-3-[(3aS)-1-oxo-3a,4,5,6-tetrahydro-1H-benzo[de]isoquinolin-2(3H)-yl]-1-azabicyclo[2.2.2]octan-1-ium chloride |
| Synonyms | Source |
|---|---|
| Palonocetron hydrochloride | ChEMBL |
| Palonosetron (as hydrochloride) | ChEMBL |
| RS-25259-197 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aloxi | KEGG DRUG |
| Palonosetron accord | ChEMBL |
| Palonosetron hospira | ChEMBL |
| Palonosetron hydrochloride component of akynzeo | ChEMBL |
| Posfrea | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21177207 | Reaxys |
| Reaxys:6641153 | Reaxys |
| CAS:135729-62-3 | ChemIDplus |
| CAS:135729-62-3 | KEGG DRUG |
| Citations |
|---|