EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O8 |
| Net Charge | 0 |
| Average Mass | 344.360 |
| Monoisotopic Mass | 344.14712 |
| SMILES | COc1cc(CCCO)ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H24O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h4-5,7,12-21H,2-3,6,8H2,1H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | QFYFLJZBZITPGX-IBEHDNSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) has functional parent dihydroconiferyl alcohol (CHEBI:4559) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) has role plant metabolite (CHEBI:76924) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) is a monomethoxybenzene (CHEBI:25235) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) is a monosaccharide derivative (CHEBI:63367) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) is a primary alcohol (CHEBI:15734) |
| dihydroconiferyl alcohol glucoside (CHEBI:85156) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-(3-hydroxypropyl)-2-methoxyphenyl β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| CPD-82 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1397859 | Reaxys |
| Citations |
|---|