EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32F6N4O |
| Net Charge | 0 |
| Average Mass | 578.601 |
| Monoisotopic Mass | 578.24803 |
| SMILES | Cc1ccccc1-c1cc(N2CCN(C)CC2)ncc1N(C)C(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H32F6N4O/c1-19-8-6-7-9-23(19)24-17-26(40-12-10-38(4)11-13-40)37-18-25(24)39(5)27(41)28(2,3)20-14-21(29(31,32)33)16-22(15-20)30(34,35)36/h6-9,14-18H,10-13H2,1-5H3 |
| InChIKey | WAXQNWCZJDTGBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | neurokinin-1 receptor antagonist An antagonist at the neurokinin-1 receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| netupitant (CHEBI:85155) has role antiemetic (CHEBI:50919) |
| netupitant (CHEBI:85155) has role antineoplastic agent (CHEBI:35610) |
| netupitant (CHEBI:85155) has role neurokinin-1 receptor antagonist (CHEBI:55350) |
| netupitant (CHEBI:85155) is a N-alkylpiperazine (CHEBI:46845) |
| netupitant (CHEBI:85155) is a N-arylpiperazine (CHEBI:46848) |
| netupitant (CHEBI:85155) is a aminopyridine (CHEBI:38207) |
| netupitant (CHEBI:85155) is a monocarboxylic acid amide (CHEBI:29347) |
| netupitant (CHEBI:85155) is a organofluorine compound (CHEBI:37143) |
| netupitant (CHEBI:85155) is a toluenes (CHEBI:27024) |
| Incoming Relation(s) |
| Akynzeo (CHEBI:85154) has part netupitant (CHEBI:85155) |
| IUPAC Name |
|---|
| 2-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethyl-N-[4-(2-methylphenyl)-6-(4-methylpiperazin-1-yl)pyridin-3-yl]propanamide |
| INN | Source |
|---|---|
| netupitant | KEGG DRUG |
| Synonyms | Source |
|---|---|
| RO-67-3189 | ChEMBL |
| RO-67-3189/000 | ChEMBL |
| RO-673189000 | ChEMBL |
| Brand Names | Source |
|---|---|
| Netupitant component of akynzeo | ChEMBL |
| Netupitant component of akynzeo capsule | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10314678 | Reaxys |
| CAS:290297-26-6 | ChemIDplus |
| CAS:290297-26-6 | KEGG DRUG |
| Citations |
|---|