EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O12 |
| Net Charge | 0 |
| Average Mass | 544.509 |
| Monoisotopic Mass | 544.15808 |
| SMILES | COC(=O)[C@@]1(O)C[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(OC)c2)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C27H28O12/c1-36-21-12-16(4-8-18(21)29)6-10-24(33)39-25-20(31)13-27(35,26(34)37-2)14-22(25)38-23(32)9-5-15-3-7-17(28)19(30)11-15/h3-12,20,22,25,28-31,35H,13-14H2,1-2H3/b9-5+,10-6+/t20-,22-,25+,27-/m1/s1 |
| InChIKey | RTLCSWCXZWROFK-XKHJDCLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) has functional parent (−)-quinic acid (CHEBI:17521) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) has functional parent trans-caffeic acid (CHEBI:16433) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) has role plant metabolite (CHEBI:76924) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) is a alkyl caffeate ester (CHEBI:65331) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) is a methyl ester (CHEBI:25248) |
| methyl 3,4-dicaffeoylquinate (CHEBI:85153) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| methyl (1R,3R,4S,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,5-dihydroxy-4-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylate |
| Synonyms | Source |
|---|---|
| methyl 3-caffeoyl-4-feruloylquinate | ChEBI |
| methyl 3-O-caffeoyl-4-O-feruloylquinate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037093 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21817159 | Reaxys |
| Citations |
|---|