EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO2 |
| Net Charge | 0 |
| Average Mass | 175.187 |
| Monoisotopic Mass | 175.06333 |
| SMILES | CC(C#N)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H9NO2/c1-7(6-11)8-3-2-4-9(5-8)10(12)13/h2-5,7H,1H3,(H,12,13) |
| InChIKey | IRYIYPWRXROPSX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-cyanoethyl)benzoic acid (CHEBI:85131) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 3-(1-cyanoethyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-(3-carboxyphenyl)propanenitrile | ChEBI |
| 2-(3-carboxyphenyl)propionitrile | ChEBI |
| 2-(3-carboxyphenyl)propiononitrile | ChEBI |
| 3-(1-Cyanethyl)benzoesäure | ChEBI |
| acide 3-(1-cyanoéthyl)benzoïque | ChEBI |
| meta-(1-cyanoethyl)benzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2211707 | Reaxys |
| CAS:5537-71-3 | ChemIDplus |
| Citations |
|---|