EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O4 |
| Net Charge | 0 |
| Average Mass | 392.495 |
| Monoisotopic Mass | 392.19876 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)ccc2c1O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C25H28O4/c1-16(2)5-4-6-17(3)7-12-20-22(27)14-13-21-23(28)15-24(29-25(20)21)18-8-10-19(26)11-9-18/h5,7-11,13-14,24,26-27H,4,6,12,15H2,1-3H3/b17-7+/t24-/m0/s1 |
| InChIKey | IJCCBLTVMMYSFZ-WAKDBBHESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-7,4'-dihydroxy-8-geranylflavanone (CHEBI:85127) has functional parent (2S)-flavanone (CHEBI:15606) |
| (2S)-7,4'-dihydroxy-8-geranylflavanone (CHEBI:85127) has role plant metabolite (CHEBI:76924) |
| (2S)-7,4'-dihydroxy-8-geranylflavanone (CHEBI:85127) is a 4'-hydroxyflavanones (CHEBI:140331) |
| (2S)-7,4'-dihydroxy-8-geranylflavanone (CHEBI:85127) is a dihydroxyflavanone (CHEBI:38749) |
| IUPAC Name |
|---|
| (2S)-8-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| Prostratol F | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00014185 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7147873 | Reaxys |