EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O8 |
| Net Charge | 0 |
| Average Mass | 386.356 |
| Monoisotopic Mass | 386.10017 |
| SMILES | COc1c(OC)c(OC)c2c(=O)c(-c3ccc4c(c3)OCO4)coc2c1OC |
| InChI | InChI=1S/C20H18O8/c1-22-16-14-15(21)11(10-5-6-12-13(7-10)28-9-27-12)8-26-17(14)19(24-3)20(25-4)18(16)23-2/h5-8H,9H2,1-4H3 |
| InChIKey | HWBCSFORKNCICS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,7,8-tetramethoxy-3',4'-methylenedioxyisoflavone (CHEBI:85126) has role plant metabolite (CHEBI:76924) |
| 5,6,7,8-tetramethoxy-3',4'-methylenedioxyisoflavone (CHEBI:85126) is a 7-methoxyisoflavones (CHEBI:140356) |
| 5,6,7,8-tetramethoxy-3',4'-methylenedioxyisoflavone (CHEBI:85126) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 3-(1,3-benzodioxol-5-yl)-5,6,7,8-tetramethoxy-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1409351 | Reaxys |