EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O4 |
| Net Charge | 0 |
| Average Mass | 380.484 |
| Monoisotopic Mass | 380.19876 |
| SMILES | C=CC(C)(C)C1=Cc2c(c(C(C)(C)C=C)c3oc(=O)ccc3c2O)OC1(C)C |
| InChI | InChI=1S/C24H28O4/c1-9-22(3,4)16-13-15-19(26)14-11-12-17(25)27-20(14)18(23(5,6)10-2)21(15)28-24(16,7)8/h9-13,26H,1-2H2,3-8H3 |
| InChIKey | OPQNNWVPHFUNEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kinocoumarin (CHEBI:85125) has role plant metabolite (CHEBI:76924) |
| kinocoumarin (CHEBI:85125) is a coumarins (CHEBI:23403) |
| kinocoumarin (CHEBI:85125) is a organic heterotricyclic compound (CHEBI:26979) |
| kinocoumarin (CHEBI:85125) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-8,8-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)-2H,8H-pyrano[3,2-g]chromen-2-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039033 | HMDB |