EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O7 |
| Net Charge | 0 |
| Average Mass | 358.346 |
| Monoisotopic Mass | 358.10525 |
| SMILES | COc1cc(OC)c2c(=O)c(O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C19H18O7/c1-22-11-8-14(25-4)16-15(9-11)26-19(18(21)17(16)20)10-5-6-12(23-2)13(7-10)24-3/h5-9,21H,1-4H3 |
| InChIKey | AAASNKNLMQBKFV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 5,7,3',4'-tetramethyl ether (CHEBI:85124) has functional parent quercetin (CHEBI:16243) |
| quercetin 5,7,3',4'-tetramethyl ether (CHEBI:85124) has role plant metabolite (CHEBI:76924) |
| quercetin 5,7,3',4'-tetramethyl ether (CHEBI:85124) is a flavonols (CHEBI:28802) |
| quercetin 5,7,3',4'-tetramethyl ether (CHEBI:85124) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 3-Hydroxy-3',4',5,7-tetramethoxyflavone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:347659 | Reaxys |
| CAS:1244-78-6 | ChemIDplus |