EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O4 |
| Net Charge | 0 |
| Average Mass | 352.430 |
| Monoisotopic Mass | 352.16746 |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(CC=C(C)C)c(OC)cc2O)cc1 |
| InChI | InChI=1S/C22H24O4/c1-15(2)5-9-17-13-19(21(24)14-22(17)26-4)20(23)12-8-16-6-10-18(25-3)11-7-16/h5-8,10-14,24H,9H2,1-4H3/b12-8+ |
| InChIKey | GCEGUTHXMYHGKF-XYOKQWHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylbavachalcone (CHEBI:85123) has role plant metabolite (CHEBI:76924) |
| 4'-O-methylbavachalcone (CHEBI:85123) is a aromatic ether (CHEBI:35618) |
| 4'-O-methylbavachalcone (CHEBI:85123) is a chalcones (CHEBI:23086) |
| 4'-O-methylbavachalcone (CHEBI:85123) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 2'-hydroxy-5'-prenyl-4,4'-dimethoxychalcone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21307944 | Reaxys |