EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H27N3O6 |
| Net Charge | 0 |
| Average Mass | 525.561 |
| Monoisotopic Mass | 525.18999 |
| SMILES | [H][C@]12C[C@](O)(C(=O)OC)[C@](C)(O1)n1c3ccccc3c3c4c(c5c6cc(OCCC)ccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C30H27N3O6/c1-4-11-38-15-9-10-19-17(12-15)23-24-18(14-31-27(24)34)22-16-7-5-6-8-20(16)33-26(22)25(23)32(19)21-13-30(36,28(35)37-3)29(33,2)39-21/h5-10,12,21,36H,4,11,13-14H2,1-3H3,(H,31,34)/t21-,29+,30+/m1/s1 |
| InChIKey | ZZWAFVPZTZSAEM-RIGQTMPJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of myosin-light-chain kinase (EC 2.7.11.18). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KT 5926 (CHEBI:85114) has role EC 2.7.11.18 (myosin-light-chain kinase) inhibitor (CHEBI:78763) |
| KT 5926 (CHEBI:85114) is a hemiaminal (CHEBI:73080) |
| KT 5926 (CHEBI:85114) is a indolocarbazole (CHEBI:51915) |
| KT 5926 (CHEBI:85114) is a methyl ester (CHEBI:25248) |
| KT 5926 (CHEBI:85114) is a organic heterooctacyclic compound (CHEBI:38165) |
| KT 5926 (CHEBI:85114) is a tertiary alcohol (CHEBI:26878) |
| KT 5926 (CHEBI:85114) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| methyl (5S,6R,8R)-6-hydroxy-5-methyl-13-oxo-11-propoxy-5,6,7,8,14,15-hexahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-6-carboxylate |
| Synonyms | Source |
|---|---|
| KT5926 | ChemIDplus |
| KT-5926 | ChemIDplus |
| 9-hydroxy-9-methoxycarbonyl-8-methyl-14-n-propoxy-2,3,9,10-tetrahydro-8,11-epoxy-1H,8H,11H-2,7b,11a-triazadibenzo(a,g)cycloocta[cde]trinden-1-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24302813 | Reaxys |
| CAS:126643-38-7 | ChemIDplus |
| Citations |
|---|