EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H6O8S2 |
| Net Charge | -2 |
| Average Mass | 366.328 |
| Monoisotopic Mass | 365.95151 |
| SMILES | O=C1c2ccc(S(=O)(=O)[O-])cc2C(=O)c2ccc(S(=O)(=O)[O-])cc21 |
| InChI | InChI=1S/C14H8O8S2/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)10-4-2-8(6-12(10)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22)/p-2 |
| InChIKey | MSSUFHMGCXOVBZ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthraquinone-2,6-disulfonate (CHEBI:85112) is a organosulfonate oxoanion (CHEBI:33554) |
| anthraquinone-2,6-disulfonate (CHEBI:85112) is conjugate base of anthraquinone-2,6-disulfonic acid (CHEBI:85115) |
| Incoming Relation(s) |
| anthraquinone-2,6-disulfonic acid (CHEBI:85115) is conjugate acid of anthraquinone-2,6-disulfonate (CHEBI:85112) |
| IUPAC Name |
|---|
| 9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate |
| Synonyms | Source |
|---|---|
| anthraquinone-2,6-disulfonate(2−) | ChEBI |
| 9,10-anthraquinone-2,6-disulfonate | ChEBI |
| AQDS | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3572067 | Reaxys |