EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O4 |
| Net Charge | 0 |
| Average Mass | 308.333 |
| Monoisotopic Mass | 308.10486 |
| SMILES | CC1(C)C=Cc2c(ccc(-c3cc4ccc(O)cc4o3)c2O)O1 |
| InChI | InChI=1S/C19H16O4/c1-19(2)8-7-14-15(23-19)6-5-13(18(14)21)17-9-11-3-4-12(20)10-16(11)22-17/h3-10,20-21H,1-2H3 |
| InChIKey | AOVQEAUIBICOLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyinflanin H (CHEBI:85109) has role plant metabolite (CHEBI:76924) |
| glyinflanin H (CHEBI:85109) is a 1-benzofurans (CHEBI:38830) |
| glyinflanin H (CHEBI:85109) is a chromenol (CHEBI:39436) |
| IUPAC Name |
|---|
| 6-(6-hydroxy-1-benzofuran-2-yl)-2,2-dimethyl-2H-chromen-5-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041303 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7141858 | Reaxys |