EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H25N3O5 |
| Net Charge | 0 |
| Average Mass | 495.535 |
| Monoisotopic Mass | 495.17942 |
| SMILES | [H][C@]12C[C@](OC)(C(=O)OC)[C@](C)(O1)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)N(C)C4 |
| InChI | InChI=1S/C29H25N3O5/c1-28-29(36-4,27(34)35-3)13-20(37-28)31-18-11-7-5-9-15(18)22-23-17(14-30(2)26(23)33)21-16-10-6-8-12-19(16)32(28)25(21)24(22)31/h5-12,20H,13-14H2,1-4H3/t20-,28+,29+/m1/s1 |
| InChIKey | QTYMDECKVKSGSM-YMUMJAELSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.12 (cGMP-dependent protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cGMP-dependent protein kinase (EC 2.7.11.12). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KT 5823 (CHEBI:85102) has role EC 2.7.11.12 (cGMP-dependent protein kinase) inhibitor (CHEBI:85113) |
| KT 5823 (CHEBI:85102) is a hemiaminal (CHEBI:73080) |
| KT 5823 (CHEBI:85102) is a indolocarbazole (CHEBI:51915) |
| KT 5823 (CHEBI:85102) is a methyl ester (CHEBI:25248) |
| KT 5823 (CHEBI:85102) is a organic heterooctacyclic compound (CHEBI:38165) |
| KT 5823 (CHEBI:85102) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| methyl (5S,6R,8R)-6-methoxy-5,14-dimethyl-13-oxo-5,6,7,8,14,15-hexahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-6-carboxylate |
| Synonyms | Source |
|---|---|
| KT-5823 | ChemIDplus |
| KT5823 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8175390 | Reaxys |
| CAS:126643-37-6 | ChemIDplus |
| Citations |
|---|