EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO6 |
| Net Charge | 0 |
| Average Mass | 259.258 |
| Monoisotopic Mass | 259.10559 |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H17NO6/c1-12(2,3)7-8(6-10(15)16)18-11(17)5-4-9(13)14/h4-5,8H,6-7H2,1-3H3,(H-,13,14,15,16)/b5-4+/t8-/m1/s1 |
| InChIKey | QMRSJQVUNCCUCI-WTSVBCDHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-fumaryl-L-carnitine (CHEBI:85093) has functional parent fumaric acid (CHEBI:18012) |
| O-fumaryl-L-carnitine (CHEBI:85093) has role metabolite (CHEBI:25212) |
| O-fumaryl-L-carnitine (CHEBI:85093) is a O-acyl-L-carnitine (CHEBI:75659) |
| O-fumaryl-L-carnitine (CHEBI:85093) is a O-fumarylcarnitine (CHEBI:87264) |
| IUPAC Name |
|---|
| (3R)-3-[({[(2E)-3-carboxyprop-2-enoyl]oxy}carbonyl)oxy]-4-(trimethylammonio)butanoate |