EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H54F2N8O6 |
| Net Charge | 0 |
| Average Mass | 889.017 |
| Monoisotopic Mass | 888.41344 |
| SMILES | COC(=O)N[C@H](C(=O)N1CC2(CC2)C[C@H]1c1ncc(-c2ccc3c(c2)C(F)(F)c2cc(-c4ccc5nc([C@@H]6[C@H]7CC[C@H](C7)N6C(=O)[C@@H](NC(=O)OC)C(C)C)nc5c4)ccc2-3)n1)C(C)C |
| InChI | InChI=1S/C49H54F2N8O6/c1-24(2)39(56-46(62)64-5)44(60)58-23-48(15-16-48)21-38(58)42-52-22-37(55-42)28-9-13-32-31-12-8-26(18-33(31)49(50,51)34(32)19-28)27-10-14-35-36(20-27)54-43(53-35)41-29-7-11-30(17-29)59(41)45(61)40(25(3)4)57-47(63)65-6/h8-10,12-14,18-20,22,24-25,29-30,38-41H,7,11,15-17,21,23H2,1-6H3,(H,52,55)(H,53,54)(H,56,62)(H,57,63)/t29-,30+,38-,39-,40-,41-/m0/s1 |
| InChIKey | VRTWBAAJJOHBQU-KMWAZVGDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ledipasvir (CHEBI:85089) has role antiviral drug (CHEBI:36044) |
| ledipasvir (CHEBI:85089) has role hepatitis C protease inhibitor (CHEBI:64924) |
| ledipasvir (CHEBI:85089) is a N-acylpyrrolidine (CHEBI:46766) |
| ledipasvir (CHEBI:85089) is a L-valine derivative (CHEBI:84129) |
| ledipasvir (CHEBI:85089) is a azaspiro compound (CHEBI:35624) |
| ledipasvir (CHEBI:85089) is a benzimidazoles (CHEBI:22715) |
| ledipasvir (CHEBI:85089) is a bridged compound (CHEBI:35990) |
| ledipasvir (CHEBI:85089) is a carbamate ester (CHEBI:23003) |
| ledipasvir (CHEBI:85089) is a carboxamide (CHEBI:37622) |
| ledipasvir (CHEBI:85089) is a fluorenes (CHEBI:24059) |
| ledipasvir (CHEBI:85089) is a imidazoles (CHEBI:24780) |
| ledipasvir (CHEBI:85089) is a organofluorine compound (CHEBI:37143) |
| Incoming Relation(s) |
| Harvoni (CHEBI:85082) has part ledipasvir (CHEBI:85089) |
| IUPAC Name |
|---|
| methyl [(2S)-1-{(6S)-6-[4-(9,9-difluoro-7-{2-[(1R,3S,4S)-2-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}-2-azabicyclo[2.2.1]hept-3-yl]-1H-benzimidazol-5-yl}-9H-fluoren-2-yl)-1H-imidazol-2-yl]-5-azaspiro[2.4]hept-5-yl}-3-methyl-1-oxobutan-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| WHO 9796 | ChemIDplus |
| GS 5885 | ChemIDplus |
| GS-5885 | ChemIDplus |
| GS5885 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10442 | KEGG DRUG |
| Ledipasvir | Wikipedia |
| 4899 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23926149 | Reaxys |
| CAS:1256388-51-8 | KEGG DRUG |
| CAS:1256388-51-8 | ChemIDplus |
| Citations |
|---|