EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | CC(C)=CCCC(C)[C@]12CC[C@@](C)(O)C1C2 |
| InChI | InChI=1S/C15H26O/c1-11(2)6-5-7-12(3)15-9-8-14(4,16)13(15)10-15/h6,12-13,16H,5,7-10H2,1-4H3/t12?,13?,14-,15-/m1/s1 |
| InChIKey | IRDFGGRWKUKANK-NEXFUWMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-sesquisabinene hydrate (CHEBI:85087) has role plant metabolite (CHEBI:76924) |
| cis-sesquisabinene hydrate (CHEBI:85087) is a sesquiterpenoid (CHEBI:26658) |
| cis-sesquisabinene hydrate (CHEBI:85087) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2R,5R)-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]bicyclo[3.1.0]hexan-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4979908 | Reaxys |