EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC(O)C(=C)[C@H](C3)C2(C)C |
| InChI | InChI=1S/C15H24O/c1-9-5-6-13-14(3,4)11-7-15(9,13)8-12(16)10(11)2/h9,11-13,16H,2,5-8H2,1,3-4H3/t9-,11+,12?,13+,15-/m1/s1 |
| InChIKey | DJYWGTBEZVORGE-CVWWDKSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cedr-8(15)-en-9-ol (CHEBI:85081) has role plant metabolite (CHEBI:76924) |
| cedr-8(15)-en-9-ol (CHEBI:85081) is a bridged compound (CHEBI:35990) |
| cedr-8(15)-en-9-ol (CHEBI:85081) is a cedrane sesquiterpenoid (CHEBI:36745) |
| cedr-8(15)-en-9-ol (CHEBI:85081) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| cedr-8(15)-en-9-ol |