EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H68O8 |
| Net Charge | 0 |
| Average Mass | 652.954 |
| Monoisotopic Mass | 652.49142 |
| SMILES | [H][C@]1([C@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C38H68O8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33(39)44-31-32(37-35(41)36(42)38(43)46-37)45-34(40)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h32,37,41-42H,3-31H2,1-2H3/t32-,37+/m0/s1 |
| InChIKey | KQZNFGJQTPAURD-NBWQQBAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascorbyl dipalmitate (CHEBI:85080) has functional parent L-ascorbic acid (CHEBI:29073) |
| ascorbyl dipalmitate (CHEBI:85080) has functional parent hexadecanoic acid (CHEBI:15756) |
| ascorbyl dipalmitate (CHEBI:85080) has role plant metabolite (CHEBI:76924) |
| ascorbyl dipalmitate (CHEBI:85080) is a ascorbic acid derivative (CHEBI:63395) |
| ascorbyl dipalmitate (CHEBI:85080) is a fatty acid ester (CHEBI:35748) |
| Synonym | Source |
|---|---|
| 5,6-O-dipalmitoyl-L-ascorbic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5367970 | Reaxys |