EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClO6 |
| Net Charge | 0 |
| Average Mass | 408.878 |
| Monoisotopic Mass | 408.13397 |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JVHXJTBJCFBINQ-ADAARDCZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dapagliflozin (CHEBI:85078) has role hypoglycemic agent (CHEBI:35526) |
| dapagliflozin (CHEBI:85078) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| dapagliflozin (CHEBI:85078) is a C-glycosyl compound (CHEBI:20857) |
| dapagliflozin (CHEBI:85078) is a aromatic ether (CHEBI:35618) |
| dapagliflozin (CHEBI:85078) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| dapagliflozin propanediol monohydrate (CHEBI:85079) has part dapagliflozin (CHEBI:85078) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[4-chloro-3-(4-ethoxybenzyl)phenyl]-D-glucitol |
| INN | Source |
|---|---|
| dapagliflozin | KEGG DRUG |
| Synonym | Source |
|---|---|
| (2S,3R,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6- (hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | ChemIDplus |
| Brand Names | Source |
|---|---|
| BMS 512148 | ChemIDplus |
| BMS-512148 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08897 | KEGG DRUG |
| Dapagliflozin | Wikipedia |
| DB06292 | DrugBank |
| 4304 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11966426 | Reaxys |
| CAS:461432-26-8 | KEGG DRUG |
| CAS:461432-26-8 | ChemIDplus |
| Citations |
|---|