EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H58N7O17P3S |
| Net Charge | 0 |
| Average Mass | 949.848 |
| Monoisotopic Mass | 949.28227 |
| SMILES | CCCCCCCCC(C)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C33H58N7O17P3S/c1-5-6-7-8-9-10-11-21(2)16-24(42)61-15-14-35-23(41)12-13-36-31(45)28(44)33(3,4)18-54-60(51,52)57-59(49,50)53-17-22-27(56-58(46,47)48)26(43)32(55-22)40-20-39-25-29(34)37-19-38-30(25)40/h19-22,26-28,32,43-44H,5-18H2,1-4H3,(H,35,41)(H,36,45)(H,49,50)(H,51,52)(H2,34,37,38)(H2,46,47,48)/t21?,22-,26-,27-,28+,32-/m1/s1 |
| InChIKey | CEPVHZBZPCWHJZ-XIRPNGCASA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylundecanoyl-CoA (CHEBI:85075) has functional parent 3-methylundecanoic acid (CHEBI:85059) |
| 3-methylundecanoyl-CoA (CHEBI:85075) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| 3-methylundecanoyl-CoA (CHEBI:85075) is a methyl-branched fatty acyl-CoA (CHEBI:25271) |
| 3-methylundecanoyl-CoA (CHEBI:85075) is a saturated fatty acyl-CoA (CHEBI:231546) |
| 3-methylundecanoyl-CoA (CHEBI:85075) is conjugate acid of 3-methylundecanoyl-CoA(4−) (CHEBI:84183) |
| Incoming Relation(s) |
| 3-methylundecanoyl-CoA(4−) (CHEBI:84183) is conjugate base of 3-methylundecanoyl-CoA (CHEBI:85075) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(3-methylundecanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonym | Source |
|---|---|
| 3-methylundecanoyl-coenzyme A | ChEBI |