EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18F3NOSi2 |
| Net Charge | 0 |
| Average Mass | 257.404 |
| Monoisotopic Mass | 257.08790 |
| SMILES | C[Si](C)(C)/N=C(/O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ |
| InChIKey | XCOBLONWWXQEBS-KPKJPENVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,O-bis(trimethylsilyl)trifluoroacetamide (CHEBI:85067) has functional parent trifluoroacetic acid (CHEBI:45892) |
| N,O-bis(trimethylsilyl)trifluoroacetamide (CHEBI:85067) has role chromatographic reagent (CHEBI:59745) |
| N,O-bis(trimethylsilyl)trifluoroacetamide (CHEBI:85067) is a N-silyl compound (CHEBI:85315) |
| N,O-bis(trimethylsilyl)trifluoroacetamide (CHEBI:85067) is a organofluorine compound (CHEBI:37143) |
| N,O-bis(trimethylsilyl)trifluoroacetamide (CHEBI:85067) is a silyl ether (CHEBI:47988) |
| IUPAC Name |
|---|
| trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)ethanimidate |
| Synonyms | Source |
|---|---|
| BSTFA | SUBMITTER |
| N,O-BSTFA | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| BSTFA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3607620 | Reaxys |
| CAS:25561-30-2 | ChemIDplus |
| CAS:25561-30-2 | NIST Chemistry WebBook |