EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N.HO |
| Net Charge | 0 |
| Average Mass | 153.225 |
| Monoisotopic Mass | 153.11536 |
| SMILES | C[N+](C)(C)c1ccccc1.[OH-] |
| InChI | InChI=1S/C9H14N.H2O/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H2/q+1;/p-1 |
| InChIKey | HADKRTWCOYPCPH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethylphenylammonium hydroxide (CHEBI:85062) has part hydroxide (CHEBI:16234) |
| trimethylphenylammonium hydroxide (CHEBI:85062) has part trimethylphenylammonium (CHEBI:85318) |
| trimethylphenylammonium hydroxide (CHEBI:85062) has role chromatographic reagent (CHEBI:59745) |
| trimethylphenylammonium hydroxide (CHEBI:85062) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| N,N,N-trimethylanilinium hydroxide |
| Synonyms | Source |
|---|---|
| N,N,N-Trimethylbenzenaminium hydroxide | ChemIDplus |
| phenyltrimethylammonium hydroxide | ChEBI |
| Phenyl trimethyl ammonium hydroxide | ChemIDplus |
| TMAH | SUBMITTER |
| Trimethylanilinium hydroxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3917033 | Reaxys |
| CAS:1899-02-1 | ChemIDplus |
| Citations |
|---|