EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/b7-4-,14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | MYHXHCUNDDAEOZ-FOSBLDSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin A2 (CHEBI:27820) has role human metabolite (CHEBI:77746) |
| prostaglandin A2 (CHEBI:27820) is a prostaglandins A (CHEBI:26334) |
| prostaglandin A2 (CHEBI:27820) is conjugate acid of prostaglandin A2(1−) (CHEBI:133370) |
| Incoming Relation(s) |
| (R)-PGA2-S-glutathione conjugate (CHEBI:136105) has functional parent prostaglandin A2 (CHEBI:27820) |
| (S)-PGA2-S-glutathione conjugate (CHEBI:136106) has functional parent prostaglandin A2 (CHEBI:27820) |
| 15-deoxy-Δ12,14-prostaglandin A2 (CHEBI:63975) has functional parent prostaglandin A2 (CHEBI:27820) |
| prostaglandin A2(1−) (CHEBI:133370) is conjugate base of prostaglandin A2 (CHEBI:27820) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,10,13-trien-1-oic acid |
| Synonyms | Source |
|---|---|
| (15S)-PGA2 | ChemIDplus |
| (15S)-Prostaglandin A2 | ChemIDplus |
| 5,6-cis-PGA2 | ChemIDplus |
| Medullin | KEGG COMPOUND |
| PGA2 | KEGG COMPOUND |
| Prostaglandin A2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05953 | KEGG COMPOUND |
| LMFA03010035 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:13345-50-1 | ChemIDplus |