EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O4 |
| Net Charge | -1 |
| Average Mass | 333.448 |
| Monoisotopic Mass | 333.20713 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/p-1/b7-4-,14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | MYHXHCUNDDAEOZ-FOSBLDSVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin A2(1−) (CHEBI:133370) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin A2(1−) (CHEBI:133370) is conjugate base of prostaglandin A2 (CHEBI:27820) |
| Incoming Relation(s) |
| (R)-PGA2-S-glutathione conjugate(2−) (CHEBI:133768) has functional parent prostaglandin A2(1−) (CHEBI:133370) |
| (S)-PGA2-S-glutathione conjugate(2−) (CHEBI:133769) has functional parent prostaglandin A2(1−) (CHEBI:133370) |
| prostaglandin A2 (CHEBI:27820) is conjugate acid of prostaglandin A2(1−) (CHEBI:133370) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,10,13-trien-1-oate |
| Synonyms | Source |
|---|---|
| PGA2 | SUBMITTER |
| prostaglandin 2 | SUBMITTER |
| (5E)-7-{2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopent-3-en-1-yl}hept-5-enoate | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin A2 | UniProt |