EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCC[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-3-1-2-5(8)4-6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | QKEWQOJCHPFEAF-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nashvillensis (ncbitaxon:67334) | - | PubMed (1490884) | Strain: MD743-GF4 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,6-diaminohexanoic acid (CHEBI:85040) has functional parent hexanoic acid (CHEBI:30776) |
| (3R)-3,6-diaminohexanoic acid (CHEBI:85040) is a diamino acid (CHEBI:35987) |
| (3R)-3,6-diaminohexanoic acid (CHEBI:85040) is a β-amino acid (CHEBI:33706) |
| (3R)-3,6-diaminohexanoic acid (CHEBI:85040) is conjugate base of (3R)-3,6-diammoniohexanoate(1+) (CHEBI:84138) |
| Incoming Relation(s) |
| (3R)-3,6-diammoniohexanoate(1+) (CHEBI:84138) is conjugate acid of (3R)-3,6-diaminohexanoic acid (CHEBI:85040) |
| IUPAC Name |
|---|
| (3R)-3,6-diaminohexanoic acid |
| Synonym | Source |
|---|---|
| D-β-lysine | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1032 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4781450 | Reaxys |
| Citations |
|---|