EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21)22/h18-19H,2-17H2,1H3,(H,21,22)/t18-,19-/m0/s1 |
| InChIKey | WGJJROVFWIXTPA-OALUTQOASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostanoic acid (CHEBI:8504) is a carbocyclic fatty acid (CHEBI:35744) |
| prostanoic acid (CHEBI:8504) is a long-chain fatty acid (CHEBI:15904) |
| prostanoic acid (CHEBI:8504) is a saturated fatty acid (CHEBI:26607) |
| Incoming Relation(s) |
| prostaglandin (CHEBI:26333) has functional parent prostanoic acid (CHEBI:8504) |
| IUPAC Names |
|---|
| 7-[(1S,2S)-2-octylcyclopentyl]heptanoic acid |
| prostan-1-oic acid |
| Synonym | Source |
|---|---|
| Prostanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02064 | KEGG COMPOUND |
| LMFA03010000 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5744307 | Reaxys |
| Citations |
|---|