EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2OS |
| Net Charge | 0 |
| Average Mass | 170.237 |
| Monoisotopic Mass | 170.05138 |
| SMILES | CCCc1cc(=O)nc(=S)n1 |
| InChI | InChI=1S/C7H10N2OS/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | KNAHARQHSZJURB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| Applications: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. antidote to paracetamol poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of paracetamol (acetaminophen). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-propyl-2-thiouracil (CHEBI:8502) has functional parent uracil (CHEBI:17568) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antidote to paracetamol poisoning (CHEBI:74529) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antimetabolite (CHEBI:35221) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antioxidant (CHEBI:22586) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antithyroid drug (CHEBI:50671) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role carcinogenic agent (CHEBI:50903) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role hormone antagonist (CHEBI:49020) |
| 6-propyl-2-thiouracil (CHEBI:8502) is a organic molecular entity (CHEBI:50860) |
| 6-propyl-2-thiouracil (CHEBI:8502) is a pyrimidinethione (CHEBI:48546) |
| Incoming Relation(s) |
| 6-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one (CHEBI:140206) has functional parent 6-propyl-2-thiouracil (CHEBI:8502) |
| IUPAC Name |
|---|
| 6-propyl-2-sulfanylidene-2,3-dihydropyrimidin-4(1H)-one |
| INNs | Source |
|---|---|
| propiltiouracilo | ChemIDplus |
| propylthiouracil | ChemIDplus |
| propylthiouracile | ChemIDplus |
| propylthiouracilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-6-propyl-2-thioxo-4(1H)-pyrimidinone | NIST Chemistry WebBook |
| 2-Mercapto-6-propyl-4-pyrimidone | ChemIDplus |
| 2-Mercapto-6-propylpyrimid-4-one | NIST Chemistry WebBook |
| 2-Thio-4-oxo-6-propyl-1,3-pyrimidine | ChemIDplus |
| 2-Thio-6-propyl-1,3-pyrimidin-4-one | ChemIDplus |
| 4-propyl-2-thiouracil | ChemIDplus |
| Brand Name | Source |
|---|---|
| Prothyran | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2308 | DrugCentral |
| C07569 | KEGG COMPOUND |
| D00562 | KEGG DRUG |
| DB00550 | DrugBank |
| HMDB0014690 | HMDB |
| LSM-5592 | LINCS |
| Propylthiouracil | Wikipedia |
| Citations |
|---|