EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8502 - 6-propyl-2-thiouracil
| Formula | C7H10N2OS |
| Net Charge | 0 |
| Average Mass | 170.237 |
| Monoisotopic Mass | 170.05138 |
| SMILES | CCCc1cc(=O)nc(=S)n1 |
| InChI | InChI=1S/C7H10N2OS/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | KNAHARQHSZJURB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. antidote to paracetamol poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of paracetamol (acetaminophen). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-propyl-2-thiouracil (CHEBI:8502) has functional parent uracil (CHEBI:17568) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antidote to paracetamol poisoning (CHEBI:74529) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antimetabolite (CHEBI:35221) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antioxidant (CHEBI:22586) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role antithyroid drug (CHEBI:50671) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role carcinogenic agent (CHEBI:50903) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 6-propyl-2-thiouracil (CHEBI:8502) has role hormone antagonist (CHEBI:49020) |
| 6-propyl-2-thiouracil (CHEBI:8502) is a pyrimidinethione (CHEBI:48546) |
| Incoming Relation(s) |
| 6-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one (CHEBI:140206) has functional parent 6-propyl-2-thiouracil (CHEBI:8502) |
| IUPAC Name |
|---|
| 6-propyl-2-sulfanylidene-2,3-dihydropyrimidin-4(1H)-one |
| INNs | Source |
|---|---|
| propiltiouracilo | ChemIDplus |
| propylthiouracil | ChemIDplus |
| propylthiouracile | ChemIDplus |
| propylthiouracilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-6-propyl-2-thioxo-4(1H)-pyrimidinone | NIST Chemistry WebBook |
| 2-Mercapto-6-propyl-4-pyrimidone | ChemIDplus |
| 2-Mercapto-6-propylpyrimid-4-one | NIST Chemistry WebBook |
| 2-Thio-4-oxo-6-propyl-1,3-pyrimidine | ChemIDplus |
| 2-Thio-6-propyl-1,3-pyrimidin-4-one | ChemIDplus |
| 4-propyl-2-thiouracil | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2308 | DrugCentral |
| C07569 | KEGG COMPOUND |
| D00562 | KEGG DRUG |
| DB00550 | DrugBank |
| HMDB0014690 | HMDB |
| LSM-5592 | LINCS |
| Propylthiouracil | Wikipedia |
| Citations |
|---|