EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | CC(=O)CCC(C)=O |
| InChI | InChI=1S/C6H10O2/c1-5(7)3-4-6(2)8/h3-4H2,1-2H3 |
| InChIKey | OJVAMHKKJGICOG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-hexanedione (CHEBI:85014) has parent hydride hexane (CHEBI:29021) |
| 2,5-hexanedione (CHEBI:85014) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,5-hexanedione (CHEBI:85014) has role neurotoxin (CHEBI:50910) |
| 2,5-hexanedione (CHEBI:85014) is a diketone (CHEBI:46640) |
| 2,5-hexanedione (CHEBI:85014) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| hexane-2,5-dione |
| Synonyms | Source |
|---|---|
| 1,2-Diacetylethane | ChemIDplus |
| 2,5-Diketohexane | ChemIDplus |
| 2,5-Hexadione | ChemIDplus |
| acetonylacetone | SUBMITTER |
| Acetonyl acetone | ChemIDplus |
| alpha,beta-Diacetylethane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,5-hexanedione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15521 | MetaCyc |
| Hexane-2,5-dione | Wikipedia |
| Citations |
|---|