EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N4O4 |
| Net Charge | 0 |
| Average Mass | 442.475 |
| Monoisotopic Mass | 442.16411 |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)/C1=N\Nc1cccc(-c2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C25H22N4O4/c1-14-10-11-19(12-15(14)2)29-24(31)22(16(3)28-29)27-26-21-9-5-8-20(23(21)30)17-6-4-7-18(13-17)25(32)33/h4-13,26,30H,1-3H3,(H,32,33)/b27-22- |
| InChIKey | XDXWLKQMMKQXPV-QYQHSDTDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. thrombopoietin receptor agonist An agonist that selectively binds to and activates the thrombopoietin receptor [myeloproliferative leukemia protein or CD110 (Cluster of Differentiation 110)]. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eltrombopag (CHEBI:85010) has role thrombopoietin receptor agonist (CHEBI:85012) |
| eltrombopag (CHEBI:85010) has role xenobiotic (CHEBI:35703) |
| eltrombopag (CHEBI:85010) is a benzoic acids (CHEBI:22723) |
| eltrombopag (CHEBI:85010) is a hydrazines (CHEBI:24631) |
| eltrombopag (CHEBI:85010) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazinyl}-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid |
| Synonym | Source |
|---|---|
| 3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazino}-2'-hydroxybiphenyl-3-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 4399 | DrugCentral |
| Eltrombopag | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:496775-61-2 | ChemIDplus |
| Citations |
|---|