EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19ClN4O2S |
| Net Charge | 0 |
| Average Mass | 414.918 |
| Monoisotopic Mass | 414.09172 |
| SMILES | COC(=O)C[C@H]1N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C20H19ClN4O2S/c1-10-11(2)28-20-17(10)18(13-5-7-14(21)8-6-13)22-15(9-16(26)27-4)19-24-23-12(3)25(19)20/h5-8,15H,9H2,1-4H3/t15-/m1/s1 |
| InChIKey | GGRCIHACOIMRKY-OAHLLOKOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MS-566 (CHEBI:84982) is a methyl ester (CHEBI:25248) |
| MS-566 (CHEBI:84982) is a monochlorobenzenes (CHEBI:83403) |
| MS-566 (CHEBI:84982) is a thienotriazolodiazepine (CHEBI:84232) |
| MS-566 (CHEBI:84982) is enantiomer of MS-417 (CHEBI:83406) |
| Incoming Relation(s) |
| MS-417 (CHEBI:83406) is enantiomer of MS-566 (CHEBI:84982) |
| IUPAC Name |
|---|
| methyl [(6R)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl]acetate |
| Synonym | Source |
|---|---|
| MS566 | ChEBI |