EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=CC(=C)C[C@@H](O)C=C(C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5-6,10-11H,1,4,7H2,2-3H3/t10-/m0/s1 |
| InChIKey | NHMKYUHMPXBMFI-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ips pini (ncbitaxon:102803) | - | PubMed (22101251) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-ipsdienol (CHEBI:84970) has role animal metabolite (CHEBI:75767) |
| (4R)-ipsdienol (CHEBI:84970) is a meroterpenoid (CHEBI:64419) |
| (4R)-ipsdienol (CHEBI:84970) is a olefinic compound (CHEBI:78840) |
| (4R)-ipsdienol (CHEBI:84970) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R)-2-methyl-6-methylideneocta-2,7-dien-4-ol |
| Synonym | Source |
|---|---|
| (R)-(−)-ipsdienol | ChEBI |
| UniProt Name | Source |
|---|---|
| (4R)-ipsdienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8835 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3587752 | Reaxys |
| CAS:60894-97-5 | ChemIDplus |
| Citations |
|---|