EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | C=CC(=C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C10H14O/c1-5-9(4)7-10(11)6-8(2)3/h5-6H,1,4,7H2,2-3H3 |
| InChIKey | RPDIIOSMVGHNKJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena anisata (ncbitaxon:159034) | |||
| leaf (BTO:0000713) | DOI (10.1080/10412905.1999.9701119) | ||
| seed (BTO:0001226) | DOI (10.1080/10412905.1999.9701119) | ||
| Ips paraconfusus (ncbitaxon:89938) | - | PubMed (24318848) | |
| Ips pini (ncbitaxon:102803) | - | PubMed (22101251) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipsdienone (CHEBI:84966) has role animal metabolite (CHEBI:75767) |
| ipsdienone (CHEBI:84966) has role plant metabolite (CHEBI:76924) |
| ipsdienone (CHEBI:84966) is a enone (CHEBI:51689) |
| ipsdienone (CHEBI:84966) is a monoterpene ketone (CHEBI:25408) |
| IUPAC Name |
|---|
| 2-methyl-6-methylideneocta-2,7-dien-4-one |
| Synonym | Source |
|---|---|
| 2-methyl-6-methylene-2,7-octadien-4-one | MetaCyc |
| UniProt Name | Source |
|---|---|
| ipsdienone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15919 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1924646 | Reaxys |
| CAS:539-70-8 | MetaCyc |
| Citations |
|---|