EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11- |
| InChIKey | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinnamomum camphora (ncbitaxon:13429) | - | PubMed (25612070) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl oleate (CHEBI:84940) has functional parent oleic acid (CHEBI:16196) |
| ethyl oleate (CHEBI:84940) has role acaricide (CHEBI:22153) |
| ethyl oleate (CHEBI:84940) has role plant metabolite (CHEBI:76924) |
| ethyl oleate (CHEBI:84940) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl (9Z)-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| oleic acid ethyl ester | ChEBI |
| Ethyl cis-9-octadecenoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethyl (9Z)-octadecenoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034451 | HMDB |
| Ethyl_oleate | Wikipedia |
| CPD-14388 | MetaCyc |
| D04090 | KEGG DRUG |
| Citations |
|---|