EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O2 |
| Net Charge | 0 |
| Average Mass | 312.538 |
| Monoisotopic Mass | 312.30283 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h3-19H2,1-2H3 |
| InChIKey | MVLVMROFTAUDAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl octadecanoate (CHEBI:84936) has role plant metabolite (CHEBI:76924) |
| ethyl octadecanoate (CHEBI:84936) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| ethyl octadecanoate (CHEBI:84936) is a octadecanoate ester (CHEBI:75925) |
| IUPAC Name |
|---|
| ethyl octadecanoate |
| Synonyms | Source |
|---|---|
| Stearic acid ethyl ester | HMDB |
| ethyl stearate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethyl octadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034156 | HMDB |
| Citations |
|---|