EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O9 |
| Net Charge | 0 |
| Average Mass | 364.351 |
| Monoisotopic Mass | 364.14818 |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H24N2O9/c1-5(13(21)22)15-12(20)6(2)24-11-9(16-7(3)18)14(23)25-8(4-17)10(11)19/h5-6,8-11,14,17,19,23H,4H2,1-3H3,(H,15,20)(H,16,18)(H,21,22)/t5-,6+,8+,9+,10+,11+,14?/m0/s1 |
| InChIKey | ICMUIFDBEVJCQA-HAFAVUGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei brucei (ncbitaxon:5702) | |||
| - | MetaboLights (MTBLS49) | Strain: WT427 | |
| - | PubMed (23571546) | Strain: WT427 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-muramoyl-L-alanine (CHEBI:84933) is a L-alanine derivative (CHEBI:83943) |
| N-acetyl-D-muramoyl-L-alanine (CHEBI:84933) is a glyco-amino acid (CHEBI:35258) |
| N-acetyl-D-muramoyl-L-alanine (CHEBI:84933) is conjugate acid of N-acetyl-D-muramoyl-L-alaninate (CHEBI:83941) |
| Incoming Relation(s) |
| N-acetyl-α-D-muramoyl-L-alanine (CHEBI:28920) is a N-acetyl-D-muramoyl-L-alanine (CHEBI:84933) |
| N-acetyl-D-muramoyl-L-alaninate (CHEBI:83941) is conjugate base of N-acetyl-D-muramoyl-L-alanine (CHEBI:84933) |
| IUPAC Name |
|---|
| 2-acetamido-3-O-[2-(L-alaninocarboxy)ethyl]-2-deoxy-D-glucose |
| Synonyms | Source |
|---|---|
| N-acetylmuramoyl-L-alanine | ChEBI |
| N-acetylmuramoylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5640852 | Reaxys |