EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O2 |
| Net Charge | 0 |
| Average Mass | 284.484 |
| Monoisotopic Mass | 284.27153 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C18H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-4-2/h3-17H2,1-2H3 |
| InChIKey | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyperus esculentus (ncbitaxon:1053340) | - | PubMed (22936608) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl hexadecanoate (CHEBI:84932) has role plant metabolite (CHEBI:76924) |
| ethyl hexadecanoate (CHEBI:84932) is a hexadecanoate ester (CHEBI:25835) |
| ethyl hexadecanoate (CHEBI:84932) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl hexadecanoate |
| Synonyms | Source |
|---|---|
| WE(2:0/16:0) | LIPID MAPS |
| Palmitic acid ethyl ester | HMDB |
| Ethyl cetylate | ChemIDplus |
| ethyl palmitate | ChEBI |
| UniProt Name | Source |
|---|---|
| ethyl hexadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA07010471 | LIPID MAPS |
| HMDB0029811 | HMDB |
| Citations |
|---|