EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29NO3 |
| Net Charge | 0 |
| Average Mass | 367.489 |
| Monoisotopic Mass | 367.21474 |
| SMILES | CCCOC(C(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-3-18-26-23(19-10-6-4-7-11-19,20-12-8-5-9-13-20)22(25)27-21-14-16-24(2)17-15-21/h4-13,21H,3,14-18H2,1-2H3 |
| InChIKey | QPCVHQBVMYCJOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Propiverine (CHEBI:8493) has role renal agent (CHEBI:35846) |
| Propiverine (CHEBI:8493) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| propiverina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mictonetten | ChEMBL |
| NSC-172140 | ChEMBL |
| Propiverine | KEGG COMPOUND |
| propiverine HCl | DrugCentral |
| propiverine hydrochloride | DrugCentral |
| Brand Names | Source |
|---|---|
| Detrunorm | ChEMBL |
| Detrunorm xl | ChEMBL |
| Mictonorm | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2300 | DrugCentral |
| C07852 | KEGG COMPOUND |
| D08441 | KEGG DRUG |
| HMDB0041999 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:60569-19-9 | KEGG COMPOUND |
| Citations |
|---|