EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2OS |
| Net Charge | 0 |
| Average Mass | 340.492 |
| Monoisotopic Mass | 340.16093 |
| SMILES | CCC(=O)c1ccc2c(c1)N(CC(C)N(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C20H24N2OS/c1-5-18(23)15-10-11-20-17(12-15)22(13-14(2)21(3)4)16-8-6-7-9-19(16)24-20/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | UVOIBTBFPOZKGP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propiomazine (CHEBI:8491) has parent hydride 10H-phenothiazine (CHEBI:37931) |
| propiomazine (CHEBI:8491) has role dopaminergic antagonist (CHEBI:48561) |
| propiomazine (CHEBI:8491) has role histamine antagonist (CHEBI:37956) |
| propiomazine (CHEBI:8491) has role muscarinic antagonist (CHEBI:48876) |
| propiomazine (CHEBI:8491) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| propiomazine (CHEBI:8491) has role sedative (CHEBI:35717) |
| propiomazine (CHEBI:8491) has role serotonergic antagonist (CHEBI:48279) |
| propiomazine (CHEBI:8491) is a aromatic ketone (CHEBI:76224) |
| propiomazine (CHEBI:8491) is a phenothiazines (CHEBI:38093) |
| propiomazine (CHEBI:8491) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| propiomazine hydrochloride (CHEBI:8492) has part propiomazine (CHEBI:8491) |
| IUPAC Name |
|---|
| 1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}propan-1-one |
| INNs | Source |
|---|---|
| propiomazina | ChEBI |
| propiomazine | ChEBI |
| propiomazinum | ChEBI |
| Synonyms | Source |
|---|---|
| 10-(2-Dimethylaminopropyl)-2-propionylphenothiazine | ChemIDplus |
| 2-Propionyl-10-(2-(dimethylamino)propyl)phenothiazine | ChemIDplus |
| 3-Propionyl-10-dimethylaminoisopropylphenothiazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2298 | DrugCentral |
| C07405 | KEGG COMPOUND |
| D02361 | KEGG DRUG |
| DB00777 | DrugBank |
| FR1176919 | Patent |
| HMDB0014915 | HMDB |
| Propiomazine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:39712 | Reaxys |
| CAS:362-29-8 | ChemIDplus |