EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48O2 |
| Net Charge | 0 |
| Average Mass | 368.646 |
| Monoisotopic Mass | 368.36543 |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C24H48O2/c1-23(2)21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24(25)26/h23H,3-22H2,1-2H3,(H,25,26) |
| InChIKey | KGHVQLDYCDULEN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (9629662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-methyltricosanoic acid (CHEBI:84903) has functional parent tricosanoic acid (CHEBI:42394) |
| 22-methyltricosanoic acid (CHEBI:84903) has role mammalian metabolite (CHEBI:75768) |
| 22-methyltricosanoic acid (CHEBI:84903) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 22-methyltricosanoic acid (CHEBI:84903) is a long-chain fatty acid (CHEBI:15904) |
| 22-methyltricosanoic acid (CHEBI:84903) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 22-methyltricosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020021 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1796702 | Reaxys |
| Citations |
|---|