EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O2 |
| Net Charge | 0 |
| Average Mass | 340.592 |
| Monoisotopic Mass | 340.33413 |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O2/c1-21(2)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22(23)24/h21H,3-20H2,1-2H3,(H,23,24) |
| InChIKey | HJVKLVGLKNGYGQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-methylhenicosanoic acid (CHEBI:84901) has functional parent henicosanoic acid (CHEBI:39248) |
| 20-methylhenicosanoic acid (CHEBI:84901) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 20-methylhenicosanoic acid (CHEBI:84901) is a long-chain fatty acid (CHEBI:15904) |
| 20-methylhenicosanoic acid (CHEBI:84901) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 20-methylhenicosanoic acid |
| Synonym | Source |
|---|---|
| Isobehenic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020019 | LIPID MAPS |
| DE10150729 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1792882 | Reaxys |