EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H58O2 |
| Net Charge | 0 |
| Average Mass | 438.781 |
| Monoisotopic Mass | 438.44368 |
| SMILES | CCC(C)CCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C29H58O2/c1-3-28(2)26-24-22-20-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21-23-25-27-29(30)31/h28H,3-27H2,1-2H3,(H,30,31) |
| InChIKey | JZQNTAVPVKXDHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-methyloctacosanoic acid (CHEBI:84885) has functional parent octacosanoic acid (CHEBI:31001) |
| 26-methyloctacosanoic acid (CHEBI:84885) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 26-methyloctacosanoic acid (CHEBI:84885) is a methyl-branched fatty acid (CHEBI:62499) |
| 26-methyloctacosanoic acid (CHEBI:84885) is a ultra-long-chain fatty acid (CHEBI:143004) |
| IUPAC Name |
|---|
| 26-methyloctacosanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1802430 | Reaxys |