EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H54O2 |
| Net Charge | 0 |
| Average Mass | 410.727 |
| Monoisotopic Mass | 410.41238 |
| SMILES | CCC(C)CCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C27H54O2/c1-3-26(2)24-22-20-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21-23-25-27(28)29/h26H,3-25H2,1-2H3,(H,28,29) |
| InChIKey | QKVYEHVFHQOMSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylhexacosanoic acid (CHEBI:84884) has functional parent hexacosanoic acid (CHEBI:31009) |
| 24-methylhexacosanoic acid (CHEBI:84884) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 24-methylhexacosanoic acid (CHEBI:84884) is a methyl-branched fatty acid (CHEBI:62499) |
| 24-methylhexacosanoic acid (CHEBI:84884) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| 24-methylhexacosanoic acid |
| Synonym | Source |
|---|---|
| 24-methylcerotic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020025 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728823 | Reaxys |