EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC |
| InChI | InChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | SSQPWTVBQMWLSZ-AAQCHOMXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has functional parent all-cis-5,8,11,14,17-icosapentaenoic acid (CHEBI:28364) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role anticholesteremic drug (CHEBI:35821) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role antidepressant (CHEBI:35469) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role antipsychotic agent (CHEBI:35476) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role marine metabolite (CHEBI:76507) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role prodrug (CHEBI:50266) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) is a polyunsaturated fatty ester (CHEBI:145039) |
| IUPAC Name |
|---|
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| INN | Source |
|---|---|
| icosapent | ChemIDplus |
| Synonyms | Source |
|---|---|
| (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid ethyl ester | KEGG COMPOUND |
| (all-Z)-5,8,11,14,17-Eicosapentaenoic acid ethyl ester | ChemIDplus |
| AMR 101 | ChemIDplus |
| AMR101 | ChemIDplus |
| cis-Eicosapentaenoic acid ethyl ester | ChemIDplus |
| E-EPA | ChEBI |
| Brand Names | Source |
|---|---|
| Epadel | ChemIDplus |
| Vascepa | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1413 | DrugCentral |
| C16184 | KEGG COMPOUND |
| D01892 | KEGG DRUG |
| Ethyl_eicosapentaenoic_acid | Wikipedia |
| HMDB0039530 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4811237 | Reaxys |
| CAS:86227-47-6 | ChemIDplus |
| CAS:86227-47-6 | KEGG COMPOUND |
| Citations |
|---|