EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC |
| InChI | InChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | SSQPWTVBQMWLSZ-AAQCHOMXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anticholesteremic drug A substance used to lower plasma cholesterol levels. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has functional parent all-cis-5,8,11,14,17-icosapentaenoic acid (CHEBI:28364) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role anticholesteremic drug (CHEBI:35821) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role antidepressant (CHEBI:35469) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role antipsychotic agent (CHEBI:35476) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role marine metabolite (CHEBI:76507) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) has role prodrug (CHEBI:50266) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate (CHEBI:84883) is a polyunsaturated fatty ester (CHEBI:145039) |
| IUPAC Name |
|---|
| ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| INN | Source |
|---|---|
| icosapent | ChemIDplus |
| Synonyms | Source |
|---|---|
| (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid ethyl ester | KEGG COMPOUND |
| (all-Z)-5,8,11,14,17-Eicosapentaenoic acid ethyl ester | ChemIDplus |
| AMR 101 | ChemIDplus |
| AMR101 | ChemIDplus |
| cis-Eicosapentaenoic acid ethyl ester | ChemIDplus |
| E-EPA | ChEBI |
| Brand Names | Source |
|---|---|
| Epadel | ChemIDplus |
| Vascepa | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1413 | DrugCentral |
| C16184 | KEGG COMPOUND |
| D01892 | KEGG DRUG |
| Ethyl_eicosapentaenoic_acid | Wikipedia |
| HMDB0039530 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4811237 | Reaxys |
| CAS:86227-47-6 | ChemIDplus |
| CAS:86227-47-6 | KEGG COMPOUND |
| Citations |
|---|