EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O16P2 |
| Net Charge | -2 |
| Average Mass | 603.327 |
| Monoisotopic Mass | 603.06260 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OC4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/p-2/t4-,5-,7-,8-,9+,10-,11+,14-,15?/m1/s1 |
| InChIKey | MVMSCBBUIHUTGJ-XIYWIPNQSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-D-mannose(2−) (CHEBI:84881) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| GDP-D-mannose(2−) (CHEBI:84881) is conjugate base of GDP-D-mannose (CHEBI:84880) |
| Incoming Relation(s) |
| GDP-D-mannose (CHEBI:84880) is conjugate acid of GDP-D-mannose(2−) (CHEBI:84881) |
| Synonyms | Source |
|---|---|
| GDP-mannose(2−) | ChEBI |
| guanosine 5'-[3-(D-mannopyranosyl) diphosphate] | ChEBI |